C20H31NO3 — CID 100734054
N-[4-[(2R)-butan-2-yl]oxyphenyl]-1-ethoxy-4-methylcyclohexane-1-carboxamide (PubChem CID 100734054) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is N-[4-[(2R)-butan-2-yl]oxyphenyl]-1-ethoxy-4-methylcyclohexane-1-carboxamide.
| Compound Name | N-[4-[(2R)-butan-2-yl]oxyphenyl]-1-ethoxy-4-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100734054 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | N-[4-[(2R)-butan-2-yl]oxyphenyl]-1-ethoxy-4-methylcyclohexane-1-carboxamide |
| SMILES | CCOC1(C(=O)Nc2ccc(O[C@H](C)CC)cc2)CCC(C)CC1 |
| InChI | InChI=1S/C20H31NO3/c1-5-16(4)24-18-9-7-17(8-10-18)21-19(22)20(23-6-2)13-11-15(3)12-14-20/h7-10,15-16H,5-6,11-14H2,1-4H3,(H,21,22)/t15?,16-,20?/m1/s1 |
| InChIKey | NXTMJGRDFKWYQO-LFDOHDQPSA-N |
| XLogP | 4.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |