C24H20N6O5 — CID 10073527
N'-[(1E,3Z)-2-benzyl-5-(2,4-dinitrophenyl)iminopenta-1,3-dienyl]pyridine-3-carbohydrazide (PubChem CID 10073527) has the molecular formula C24H20N6O5 and a molecular weight of 472.46 g/mol. Its IUPAC name is N'-[(1E,3Z)-2-benzyl-5-(2,4-dinitrophenyl)iminopenta-1,3-dienyl]pyridine-3-carbohydrazide.
| Compound Name | N'-[(1E,3Z)-2-benzyl-5-(2,4-dinitrophenyl)iminopenta-1,3-dienyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 10073527 |
| Molecular Formula | C24H20N6O5 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | N'-[(1E,3Z)-2-benzyl-5-(2,4-dinitrophenyl)iminopenta-1,3-dienyl]pyridine-3-carbohydrazide |
| SMILES | O=C(NN/C=C(/C=C\C=N\c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])Cc1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C24H20N6O5/c31-24(20-9-5-12-25-17-20)28-27-16-19(14-18-6-2-1-3-7-18)8-4-13-26-22-11-10-21(29(32)33)15-23(22)30(34)35/h1-13,15-17,27H,14H2,(H,28,31)/b8-4-,19-16-,26-13+ |
| InChIKey | UNOYFICMCDRZJG-OMLOBXIJSA-N |
| XLogP | 4.22 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|