C25H49FO3Si2 — CID 10073560
(2Z)-2-[(3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(4-fluorobutyl)-2-methylidenecyclohexylidene]ethanol (PubChem CID 10073560) has the molecular formula C25H49FO3Si2 and a molecular weight of 472.83 g/mol. Its IUPAC name is (2Z)-2-[(3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(4-fluorobutyl)-2-methylidenecyclohexylidene]ethanol.
| Compound Name | (2Z)-2-[(3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(4-fluorobutyl)-2-methylidenecyclohexylidene]ethanol |
|---|---|
| PubChem CID | 10073560 |
| Molecular Formula | C25H49FO3Si2 |
| Molecular Weight | 472.83 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | (2Z)-2-[(3S,4S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-(4-fluorobutyl)-2-methylidenecyclohexylidene]ethanol |
| SMILES | C=C1/C(=C\CO)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CCCCF)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H49FO3Si2/c1-19-20(15-17-27)18-22(28-30(8,9)24(2,3)4)21(14-12-13-16-26)23(19)29-31(10,11)25(5,6)7/h15,21-23,27H,1,12-14,16-18H2,2-11H3/b20-15-/t21-,22+,23+/m0/s1 |
| InChIKey | WQINFRATUJCNLT-RYZTUPOOSA-N |
| XLogP | 7.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.83 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|