C18H24F5N3O4S — CID 10073569
N-hydroxy-2-methyl-2-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylpropanamide (PubChem CID 10073569) has the molecular formula C18H24F5N3O4S and a molecular weight of 473.46 g/mol. Its IUPAC name is N-hydroxy-2-methyl-2-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylpropanamide.
| Compound Name | N-hydroxy-2-methyl-2-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylpropanamide |
|---|---|
| PubChem CID | 10073569 |
| Molecular Formula | C18H24F5N3O4S |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-hydroxy-2-methyl-2-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylpropanamide |
| SMILES | CC(C)(C(=O)NO)S(=O)(=O)N1CCC(c2ccc(CCC(F)(F)C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C18H24F5N3O4S/c1-16(2,15(27)25-28)31(29,30)26-9-6-13(7-10-26)14-4-3-12(11-24-14)5-8-17(19,20)18(21,22)23/h3-4,11,13,28H,5-10H2,1-2H3,(H,25,27) |
| InChIKey | DIXCEKMRINKFMZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|