C28H43NO5 — CID 10073584
(2S,5R,10R,11S)-5-benzyl-10-heptyl-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione (PubChem CID 10073584) has the molecular formula C28H43NO5 and a molecular weight of 473.65 g/mol. Its IUPAC name is (2S,5R,10R,11S)-5-benzyl-10-heptyl-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione.
| Compound Name | (2S,5R,10R,11S)-5-benzyl-10-heptyl-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione |
|---|---|
| PubChem CID | 10073584 |
| Molecular Formula | C28H43NO5 |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.31 |
| IUPAC Name | (2S,5R,10R,11S)-5-benzyl-10-heptyl-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione |
| SMILES | CCCCCCC[C@H]1OC(=O)CC[C@H](Cc2ccccc2)N(C)C(=O)[C@H](C(C)C)OC(=O)[C@H]1C |
| InChI | InChI=1S/C28H43NO5/c1-6-7-8-9-13-16-24-21(4)28(32)34-26(20(2)3)27(31)29(5)23(17-18-25(30)33-24)19-22-14-11-10-12-15-22/h10-12,14-15,20-21,23-24,26H,6-9,13,16-19H2,1-5H3/t21-,23+,24+,26-/m0/s1 |
| InChIKey | VHUIPQJPOUPXDB-PFHLPCBSSA-N |
| XLogP | 5.33 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|