C24H47FO4Si2 — CID 10073618
methyl (4R,5S,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(4-fluorobutyl)cyclohexene-1-carboxylate (PubChem CID 10073618) has the molecular formula C24H47FO4Si2 and a molecular weight of 474.81 g/mol. Its IUPAC name is methyl (4R,5S,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(4-fluorobutyl)cyclohexene-1-carboxylate.
| Compound Name | methyl (4R,5S,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(4-fluorobutyl)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 10073618 |
| Molecular Formula | C24H47FO4Si2 |
| Molecular Weight | 474.81 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | methyl (4R,5S,6S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(4-fluorobutyl)cyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CCCCF)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H47FO4Si2/c1-23(2,3)30(8,9)28-20-16-15-19(22(26)27-7)21(18(20)14-12-13-17-25)29-31(10,11)24(4,5)6/h15,18,20-21H,12-14,16-17H2,1-11H3/t18-,20+,21-/m0/s1 |
| InChIKey | SOBMQGAXSCNZBZ-TYPHKJRUSA-N |
| XLogP | 7.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.81 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|