C29H36N2O4 — CID 10073708
1,3-dihydroxy-10-methoxy-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-11H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 10073708) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is 1,3-dihydroxy-10-methoxy-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-11H-benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 1,3-dihydroxy-10-methoxy-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-11H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 10073708 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 1,3-dihydroxy-10-methoxy-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-11H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | COc1cccc2c1Nc1c(O)cc(O)cc1N(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C2=O |
| InChI | InChI=1S/C29H36N2O4/c1-19(2)9-6-10-20(3)11-7-12-21(4)15-16-31-24-17-22(32)18-25(33)28(24)30-27-23(29(31)34)13-8-14-26(27)35-5/h8-9,11,13-15,17-18,30,32-33H,6-7,10,12,16H2,1-5H3/b20-11+,21-15+ |
| InChIKey | JTXCKBNGXFBVIN-JAGDBARYSA-N |
| XLogP | 7.23 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|