C16H24N4O3 — CID 100737772
2-methyl-5-nitro-N-[[(2R)-1,3,3-trimethylpiperidin-2-yl]methyl]pyridine-3-carboxamide (PubChem CID 100737772) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-methyl-5-nitro-N-[[(2R)-1,3,3-trimethylpiperidin-2-yl]methyl]pyridine-3-carboxamide.
| Compound Name | 2-methyl-5-nitro-N-[[(2R)-1,3,3-trimethylpiperidin-2-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 100737772 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-methyl-5-nitro-N-[[(2R)-1,3,3-trimethylpiperidin-2-yl]methyl]pyridine-3-carboxamide |
| SMILES | Cc1ncc([N+](=O)[O-])cc1C(=O)NC[C@@H]1N(C)CCCC1(C)C |
| InChI | InChI=1S/C16H24N4O3/c1-11-13(8-12(9-17-11)20(22)23)15(21)18-10-14-16(2,3)6-5-7-19(14)4/h8-9,14H,5-7,10H2,1-4H3,(H,18,21)/t14-/m0/s1 |
| InChIKey | ADQBPXMNKMBBGJ-AWEZNQCLSA-N |
| XLogP | 2.15 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|