About (1S)-1-(4,5-dimethylfuran-2-yl)-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine
(1S)-1-(4,5-dimethylfuran-2-yl)-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine (PubChem CID 100737963) has the molecular formula C18H25N3O
and a molecular weight of 299.42 g/mol. Its IUPAC name is (1S)-1-(4,5-dimethylfuran-2-yl)-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine.
Molecular Properties
| Compound Name | (1S)-1-(4,5-dimethylfuran-2-yl)-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine |
| PubChem CID | 100737963 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | (1S)-1-(4,5-dimethylfuran-2-yl)-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine |
| SMILES | Cc1cc([C@H](C)NCc2ccnc(N3CCCC3)c2)oc1C |
| InChI | InChI=1S/C18H25N3O/c1-13-10-17(22-15(13)3)14(2)20-12-16-6-7-19-18(11-16)21-8-4-5-9-21/h6-7,10-11,14,20H,4-5,8-9,12H2,1-3H3/t14-/m0/s1 |
| InChIKey | VTOLEMDHVGYKAG-AWEZNQCLSA-N |
| XLogP | 3.74 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-1-(4,5-dimethylfuran-2-yl)-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(4,5-dimethylfuran-2-yl)-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine?
The IUPAC name of (1S)-1-(4,5-dimethylfuran-2-yl)-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine (CID 100737963) is (1S)-1-(4,5-dimethylfuran-2-yl)-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine.
What is the SMILES notation for (1S)-1-(4,5-dimethylfuran-2-yl)-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine?
The canonical SMILES for (1S)-1-(4,5-dimethylfuran-2-yl)-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine is Cc1cc([C@H](C)NCc2ccnc(N3CCCC3)c2)oc1C.
What is the InChIKey of (1S)-1-(4,5-dimethylfuran-2-yl)-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine?
The InChIKey is VTOLEMDHVGYKAG-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H25N3O/c1-13-10-17(22-15(13)3)14(2)20-12-16-6-7-19-18(11-16)21-8-4-5-9-21/h6-7,10-11,14,20H,4-5,8-9,12H2,1-3H3/t14-/m0/s1.
What are the key properties of (1S)-1-(4,5-dimethylfuran-2-yl)-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine?
(1S)-1-(4,5-dimethylfuran-2-yl)-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine has a molecular weight of 299.42 g/mol, XLogP of 3.74, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(4,5-dimethylfuran-2-yl)-N-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine is sourced from PubChem (CID 100737963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).