C20H17F4N7O3 — CID 10073832
5-[[6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-5-propan-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-2,4-difluoro-N-methoxybenzamide (PubChem CID 10073832) has the molecular formula C20H17F4N7O3 and a molecular weight of 479.39 g/mol. Its IUPAC name is 5-[[6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-5-propan-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-2,4-difluoro-N-methoxybenzamide.
| Compound Name | 5-[[6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-5-propan-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-2,4-difluoro-N-methoxybenzamide |
|---|---|
| PubChem CID | 10073832 |
| Molecular Formula | C20H17F4N7O3 |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 5-[[6-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-5-propan-2-ylpyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-2,4-difluoro-N-methoxybenzamide |
| SMILES | CONC(=O)c1cc(Nc2ncnn3cc(-c4nnc(C(F)F)o4)c(C(C)C)c23)c(F)cc1F |
| InChI | InChI=1S/C20H17F4N7O3/c1-8(2)14-10(19-28-29-20(34-19)16(23)24)6-31-15(14)17(25-7-26-31)27-13-4-9(18(32)30-33-3)11(21)5-12(13)22/h4-8,16H,1-3H3,(H,30,32)(H,25,26,27) |
| InChIKey | BPXQYAXTDCQZHB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|