C23H38N2O3 — CID 100739818
(2R)-2-methyl-N-[4-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]-2-propoxypentanamide (PubChem CID 100739818) has the molecular formula C23H38N2O3 and a molecular weight of 390.57 g/mol. Its IUPAC name is (2R)-2-methyl-N-[4-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]-2-propoxypentanamide.
| Compound Name | (2R)-2-methyl-N-[4-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]-2-propoxypentanamide |
|---|---|
| PubChem CID | 100739818 |
| Molecular Formula | C23H38N2O3 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | (2R)-2-methyl-N-[4-[2-(4-methylpiperidin-1-yl)ethoxy]phenyl]-2-propoxypentanamide |
| SMILES | CCCO[C@](C)(CCC)C(=O)Nc1ccc(OCCN2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C23H38N2O3/c1-5-13-23(4,28-17-6-2)22(26)24-20-7-9-21(10-8-20)27-18-16-25-14-11-19(3)12-15-25/h7-10,19H,5-6,11-18H2,1-4H3,(H,24,26)/t23-/m1/s1 |
| InChIKey | GLHSCGYEQQACQA-HSZRJFAPSA-N |
| XLogP | 4.72 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |