C26H33Cl2N3O4 — CID 100741022
(2R)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(2,6-dichlorophenyl)methyl]amino]-N-[(2S)-butan-2-yl]butanamide (PubChem CID 100741022) has the molecular formula C26H33Cl2N3O4 and a molecular weight of 522.47 g/mol. Its IUPAC name is (2R)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(2,6-dichlorophenyl)methyl]amino]-N-[(2S)-butan-2-yl]butanamide.
| Compound Name | (2R)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(2,6-dichlorophenyl)methyl]amino]-N-[(2S)-butan-2-yl]butanamide |
|---|---|
| PubChem CID | 100741022 |
| Molecular Formula | C26H33Cl2N3O4 |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | (2R)-2-[3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyl-[(2,6-dichlorophenyl)methyl]amino]-N-[(2S)-butan-2-yl]butanamide |
| SMILES | CC[C@H](C(=O)N[C@@H](C)CC)N(Cc1c(Cl)cccc1Cl)C(=O)CCN1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C26H33Cl2N3O4/c1-4-16(3)29-24(33)22(5-2)31(15-19-20(27)11-8-12-21(19)28)23(32)13-14-30-25(34)17-9-6-7-10-18(17)26(30)35/h6-8,11-12,16-18,22H,4-5,9-10,13-15H2,1-3H3,(H,29,33)/t16-,17-,18+,22+/m0/s1 |
| InChIKey | IXQROLZINDVARE-VDVULAQNSA-N |
| XLogP | 4.36 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|