C21H23Cl2N3O4 — CID 10074253
2-(4,5-dichloro-2-nitrophenyl)-N-[(1S)-2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-phenylethyl]-N-methylacetamide (PubChem CID 10074253) has the molecular formula C21H23Cl2N3O4 and a molecular weight of 452.34 g/mol. Its IUPAC name is 2-(4,5-dichloro-2-nitrophenyl)-N-[(1S)-2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-phenylethyl]-N-methylacetamide.
| Compound Name | 2-(4,5-dichloro-2-nitrophenyl)-N-[(1S)-2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-phenylethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 10074253 |
| Molecular Formula | C21H23Cl2N3O4 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 2-(4,5-dichloro-2-nitrophenyl)-N-[(1S)-2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-phenylethyl]-N-methylacetamide |
| SMILES | CN(C(=O)Cc1cc(Cl)c(Cl)cc1[N+](=O)[O-])[C@H](CN1CC[C@H](O)C1)c1ccccc1 |
| InChI | InChI=1S/C21H23Cl2N3O4/c1-24(21(28)10-15-9-17(22)18(23)11-19(15)26(29)30)20(14-5-3-2-4-6-14)13-25-8-7-16(27)12-25/h2-6,9,11,16,20,27H,7-8,10,12-13H2,1H3/t16-,20+/m0/s1 |
| InChIKey | IHQSWCDVZMEUCF-OXJNMPFZSA-N |
| XLogP | 3.71 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|