C25H31NO9 — CID 10074275
[(2R,3S,6R)-3-acetyloxy-6-[(2S,3R)-1-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxoazetidin-3-yl]oxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 10074275) has the molecular formula C25H31NO9 and a molecular weight of 489.52 g/mol. Its IUPAC name is [(2R,3S,6R)-3-acetyloxy-6-[(2S,3R)-1-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxoazetidin-3-yl]oxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6R)-3-acetyloxy-6-[(2S,3R)-1-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxoazetidin-3-yl]oxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10074275 |
| Molecular Formula | C25H31NO9 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | [(2R,3S,6R)-3-acetyloxy-6-[(2S,3R)-1-benzyl-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxoazetidin-3-yl]oxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](O[C@H]2C(=O)N(Cc3ccccc3)[C@H]2[C@H]2COC(C)(C)O2)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H31NO9/c1-15(27)30-13-19-18(32-16(2)28)10-11-21(33-19)34-23-22(20-14-31-25(3,4)35-20)26(24(23)29)12-17-8-6-5-7-9-17/h5-11,18-23H,12-14H2,1-4H3/t18-,19+,20+,21+,22-,23+/m0/s1 |
| InChIKey | RYOTXVZEDFABFJ-HZMAHWLLSA-N |
| XLogP | 1.71 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|