C28H32FN5O2 — CID 10074279
(3Z)-3-[(3-fluoro-4-methylphenyl)-(5-methyl-1H-imidazol-2-yl)methylidene]-5-[[1-(2-methoxyethyl)piperidin-4-yl]amino]-1H-indol-2-one (PubChem CID 10074279) has the molecular formula C28H32FN5O2 and a molecular weight of 489.60 g/mol. Its IUPAC name is (3Z)-3-[(3-fluoro-4-methylphenyl)-(5-methyl-1H-imidazol-2-yl)methylidene]-5-[[1-(2-methoxyethyl)piperidin-4-yl]amino]-1H-indol-2-one.
| Compound Name | (3Z)-3-[(3-fluoro-4-methylphenyl)-(5-methyl-1H-imidazol-2-yl)methylidene]-5-[[1-(2-methoxyethyl)piperidin-4-yl]amino]-1H-indol-2-one |
|---|---|
| PubChem CID | 10074279 |
| Molecular Formula | C28H32FN5O2 |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | (3Z)-3-[(3-fluoro-4-methylphenyl)-(5-methyl-1H-imidazol-2-yl)methylidene]-5-[[1-(2-methoxyethyl)piperidin-4-yl]amino]-1H-indol-2-one |
| SMILES | COCCN1CCC(Nc2ccc3c(c2)/C(=C(\c2ccc(C)c(F)c2)c2ncc(C)[nH]2)C(=O)N3)CC1 |
| InChI | InChI=1S/C28H32FN5O2/c1-17-4-5-19(14-23(17)29)25(27-30-16-18(2)31-27)26-22-15-21(6-7-24(22)33-28(26)35)32-20-8-10-34(11-9-20)12-13-36-3/h4-7,14-16,20,32H,8-13H2,1-3H3,(H,30,31)(H,33,35)/b26-25- |
| InChIKey | DTSLUDBVYDSFSI-QPLCGJKRSA-N |
| XLogP | 4.60 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|