C35H38N4O6S — CID 100742911
(2S)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide (PubChem CID 100742911) has the molecular formula C35H38N4O6S and a molecular weight of 642.78 g/mol. Its IUPAC name is (2S)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 100742911 |
| Molecular Formula | C35H38N4O6S |
| Molecular Weight | 642.78 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | (2S)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2-methylphenyl)methyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide |
| SMILES | Cc1ccccc1CN(C(=O)CN(c1cccc([N+](=O)[O-])c1)S(=O)(=O)c1ccccc1)[C@@H](Cc1ccccc1)C(=O)NCC(C)C |
| InChI | InChI=1S/C35H38N4O6S/c1-26(2)23-36-35(41)33(21-28-14-6-4-7-15-28)37(24-29-16-11-10-13-27(29)3)34(40)25-38(30-17-12-18-31(22-30)39(42)43)46(44,45)32-19-8-5-9-20-32/h4-20,22,26,33H,21,23-25H2,1-3H3,(H,36,41)/t33-/m0/s1 |
| InChIKey | BPFFGAHQQJQNPP-XIFFEERXSA-N |
| XLogP | 5.51 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.78 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|