C23H24FN2O7P — CID 10074305
5-(diethoxyphosphorylmethoxy)-7-[(4-fluorophenyl)methyl]-6,9-dihydroxy-6H-pyrrolo[3,4-g]quinolin-8-one (PubChem CID 10074305) has the molecular formula C23H24FN2O7P and a molecular weight of 490.42 g/mol. Its IUPAC name is 5-(diethoxyphosphorylmethoxy)-7-[(4-fluorophenyl)methyl]-6,9-dihydroxy-6H-pyrrolo[3,4-g]quinolin-8-one.
| Compound Name | 5-(diethoxyphosphorylmethoxy)-7-[(4-fluorophenyl)methyl]-6,9-dihydroxy-6H-pyrrolo[3,4-g]quinolin-8-one |
|---|---|
| PubChem CID | 10074305 |
| Molecular Formula | C23H24FN2O7P |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 5-(diethoxyphosphorylmethoxy)-7-[(4-fluorophenyl)methyl]-6,9-dihydroxy-6H-pyrrolo[3,4-g]quinolin-8-one |
| SMILES | CCOP(=O)(COc1c2c(c(O)c3ncccc13)C(=O)N(Cc1ccc(F)cc1)C2O)OCC |
| InChI | InChI=1S/C23H24FN2O7P/c1-3-32-34(30,33-4-2)13-31-21-16-6-5-11-25-19(16)20(27)17-18(21)23(29)26(22(17)28)12-14-7-9-15(24)10-8-14/h5-11,23,27,29H,3-4,12-13H2,1-2H3 |
| InChIKey | ZLEPXYVSUXKIOY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|