About 3-[(1R)-1-methoxyethyl]-5-(4-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole
3-[(1R)-1-methoxyethyl]-5-(4-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole (PubChem CID 100743288) has the molecular formula C14H14N4O2S
and a molecular weight of 302.36 g/mol. Its IUPAC name is 3-[(1R)-1-methoxyethyl]-5-(4-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 3-[(1R)-1-methoxyethyl]-5-(4-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole |
| PubChem CID | 100743288 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 3-[(1R)-1-methoxyethyl]-5-(4-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole |
| SMILES | CO[C@H](C)c1nsc(Oc2ccc(-n3cccn3)cc2)n1 |
| InChI | InChI=1S/C14H14N4O2S/c1-10(19-2)13-16-14(21-17-13)20-12-6-4-11(5-7-12)18-9-3-8-15-18/h3-10H,1-2H3/t10-/m1/s1 |
| InChIKey | KMJLPPHJEZRSAA-SNVBAGLBSA-N |
| XLogP | 3.22 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[(1R)-1-methoxyethyl]-5-(4-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R)-1-methoxyethyl]-5-(4-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole?
The IUPAC name of 3-[(1R)-1-methoxyethyl]-5-(4-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole (CID 100743288) is 3-[(1R)-1-methoxyethyl]-5-(4-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole.
What is the SMILES notation for 3-[(1R)-1-methoxyethyl]-5-(4-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole?
The canonical SMILES for 3-[(1R)-1-methoxyethyl]-5-(4-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole is CO[C@H](C)c1nsc(Oc2ccc(-n3cccn3)cc2)n1.
What is the InChIKey of 3-[(1R)-1-methoxyethyl]-5-(4-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole?
The InChIKey is KMJLPPHJEZRSAA-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H14N4O2S/c1-10(19-2)13-16-14(21-17-13)20-12-6-4-11(5-7-12)18-9-3-8-15-18/h3-10H,1-2H3/t10-/m1/s1.
What are the key properties of 3-[(1R)-1-methoxyethyl]-5-(4-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole?
3-[(1R)-1-methoxyethyl]-5-(4-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole has a molecular weight of 302.36 g/mol, XLogP of 3.22, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R)-1-methoxyethyl]-5-(4-pyrazol-1-ylphenoxy)-1,2,4-thiadiazole is sourced from PubChem (CID 100743288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).