C21H26ClNO2 — CID 100743652
(2S)-2-(3-chlorophenoxy)-N-[(2,5-diethylphenyl)methyl]butanamide (PubChem CID 100743652) has the molecular formula C21H26ClNO2 and a molecular weight of 359.90 g/mol. Its IUPAC name is (2S)-2-(3-chlorophenoxy)-N-[(2,5-diethylphenyl)methyl]butanamide.
| Compound Name | (2S)-2-(3-chlorophenoxy)-N-[(2,5-diethylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 100743652 |
| Molecular Formula | C21H26ClNO2 |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (2S)-2-(3-chlorophenoxy)-N-[(2,5-diethylphenyl)methyl]butanamide |
| SMILES | CCc1ccc(CC)c(CNC(=O)[C@H](CC)Oc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C21H26ClNO2/c1-4-15-10-11-16(5-2)17(12-15)14-23-21(24)20(6-3)25-19-9-7-8-18(22)13-19/h7-13,20H,4-6,14H2,1-3H3,(H,23,24)/t20-/m0/s1 |
| InChIKey | WOKFXJAQRQYHNV-FQEVSTJZSA-N |
| XLogP | 4.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |