C31H44N2OS — CID 10074408
(3E)-N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-3-methoxyimino-3-(4-methylsulfanylphenyl)propan-1-amine (PubChem CID 10074408) has the molecular formula C31H44N2OS and a molecular weight of 492.77 g/mol. Its IUPAC name is (3E)-N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-3-methoxyimino-3-(4-methylsulfanylphenyl)propan-1-amine.
| Compound Name | (3E)-N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-3-methoxyimino-3-(4-methylsulfanylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 10074408 |
| Molecular Formula | C31H44N2OS |
| Molecular Weight | 492.77 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | (3E)-N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-3-methoxyimino-3-(4-methylsulfanylphenyl)propan-1-amine |
| SMILES | CO/N=C(\CCNCC1(C)CCCC2(C)c3ccc(C(C)C)cc3CCC12)c1ccc(SC)cc1 |
| InChI | InChI=1S/C31H44N2OS/c1-22(2)24-10-14-27-25(20-24)11-15-29-30(3,17-7-18-31(27,29)4)21-32-19-16-28(33-34-5)23-8-12-26(35-6)13-9-23/h8-10,12-14,20,22,29,32H,7,11,15-19,21H2,1-6H3/b33-28+ |
| InChIKey | JIFUDSCZSQZYHI-PJJLUWSFSA-N |
| XLogP | 7.57 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.77 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|