C28H23N5O4 — CID 10074426
3-(5-tert-butyl-[1,2]oxazolo[4,5-b]pyridin-3-yl)-5-methyl-1-(4-nitrophenyl)pyrido[3,2-b]indol-2-one (PubChem CID 10074426) has the molecular formula C28H23N5O4 and a molecular weight of 493.52 g/mol. Its IUPAC name is 3-(5-tert-butyl-[1,2]oxazolo[4,5-b]pyridin-3-yl)-5-methyl-1-(4-nitrophenyl)pyrido[3,2-b]indol-2-one.
| Compound Name | 3-(5-tert-butyl-[1,2]oxazolo[4,5-b]pyridin-3-yl)-5-methyl-1-(4-nitrophenyl)pyrido[3,2-b]indol-2-one |
|---|---|
| PubChem CID | 10074426 |
| Molecular Formula | C28H23N5O4 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 3-(5-tert-butyl-[1,2]oxazolo[4,5-b]pyridin-3-yl)-5-methyl-1-(4-nitrophenyl)pyrido[3,2-b]indol-2-one |
| SMILES | Cn1c2ccccc2c2c1cc(-c1noc3ccc(C(C)(C)C)nc13)c(=O)n2-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H23N5O4/c1-28(2,3)23-14-13-22-25(29-23)24(30-37-22)19-15-21-26(18-7-5-6-8-20(18)31(21)4)32(27(19)34)16-9-11-17(12-10-16)33(35)36/h5-15H,1-4H3 |
| InChIKey | RPXZKSDSKUIMQS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 108.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|