C23H19F5N4O3 — CID 10074455
methyl 2-[6-[[[4-methyl-3-(2,2,3,3,3-pentafluoropropanoylamino)-2-pyridinyl]amino]methyl]-3-pyridinyl]benzoate (PubChem CID 10074455) has the molecular formula C23H19F5N4O3 and a molecular weight of 494.42 g/mol. Its IUPAC name is methyl 2-[6-[[[4-methyl-3-(2,2,3,3,3-pentafluoropropanoylamino)-2-pyridinyl]amino]methyl]-3-pyridinyl]benzoate.
| Compound Name | methyl 2-[6-[[[4-methyl-3-(2,2,3,3,3-pentafluoropropanoylamino)-2-pyridinyl]amino]methyl]-3-pyridinyl]benzoate |
|---|---|
| PubChem CID | 10074455 |
| Molecular Formula | C23H19F5N4O3 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | methyl 2-[6-[[[4-methyl-3-(2,2,3,3,3-pentafluoropropanoylamino)-2-pyridinyl]amino]methyl]-3-pyridinyl]benzoate |
| SMILES | COC(=O)c1ccccc1-c1ccc(CNc2nccc(C)c2NC(=O)C(F)(F)C(F)(F)F)nc1 |
| InChI | InChI=1S/C23H19F5N4O3/c1-13-9-10-29-19(18(13)32-21(34)22(24,25)23(26,27)28)31-12-15-8-7-14(11-30-15)16-5-3-4-6-17(16)20(33)35-2/h3-11H,12H2,1-2H3,(H,29,31)(H,32,34) |
| InChIKey | JVJYPWXSPNXREC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|