About N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclopropanesulfonamide
N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclopropanesulfonamide (PubChem CID 100744625) has the molecular formula C11H23NO3S
and a molecular weight of 249.38 g/mol. Its IUPAC name is N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclopropanesulfonamide.
Molecular Properties
| Compound Name | N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclopropanesulfonamide |
| PubChem CID | 100744625 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclopropanesulfonamide |
| SMILES | COCC[C@H](NS(=O)(=O)C1CC1)C(C)(C)C |
| InChI | InChI=1S/C11H23NO3S/c1-11(2,3)10(7-8-15-4)12-16(13,14)9-5-6-9/h9-10,12H,5-8H2,1-4H3/t10-/m0/s1 |
| InChIKey | SGRXQPXTRPEZMT-JTQLQIEISA-N |
| XLogP | 1.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclopropanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclopropanesulfonamide?
The IUPAC name of N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclopropanesulfonamide (CID 100744625) is N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclopropanesulfonamide.
What is the SMILES notation for N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclopropanesulfonamide?
The canonical SMILES for N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclopropanesulfonamide is COCC[C@H](NS(=O)(=O)C1CC1)C(C)(C)C.
What is the InChIKey of N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclopropanesulfonamide?
The InChIKey is SGRXQPXTRPEZMT-JTQLQIEISA-N. The full InChI is InChI=1S/C11H23NO3S/c1-11(2,3)10(7-8-15-4)12-16(13,14)9-5-6-9/h9-10,12H,5-8H2,1-4H3/t10-/m0/s1.
What are the key properties of N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclopropanesulfonamide?
N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclopropanesulfonamide has a molecular weight of 249.38 g/mol, XLogP of 1.52, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-1-methoxy-4,4-dimethylpentan-3-yl]cyclopropanesulfonamide is sourced from PubChem (CID 100744625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).