C20H23N3O3 — CID 100745438
3-[1-[(1S)-cyclohex-3-ene-1-carbonyl]piperidin-4-yl]-1H-quinazoline-2,4-dione (PubChem CID 100745438) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 3-[1-[(1S)-cyclohex-3-ene-1-carbonyl]piperidin-4-yl]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[1-[(1S)-cyclohex-3-ene-1-carbonyl]piperidin-4-yl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 100745438 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 3-[1-[(1S)-cyclohex-3-ene-1-carbonyl]piperidin-4-yl]-1H-quinazoline-2,4-dione |
| SMILES | O=C([C@@H]1CC=CCC1)N1CCC(n2c(=O)[nH]c3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C20H23N3O3/c24-18(14-6-2-1-3-7-14)22-12-10-15(11-13-22)23-19(25)16-8-4-5-9-17(16)21-20(23)26/h1-2,4-5,8-9,14-15H,3,6-7,10-13H2,(H,21,26)/t14-/m1/s1 |
| InChIKey | WOFOPHFMTICRKH-CQSZACIVSA-N |
| XLogP | 2.21 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|