C26H22N6O5 — CID 10074624
1-[6-[2-(4-methoxyphenyl)indazol-5-yl]oxy-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione (PubChem CID 10074624) has the molecular formula C26H22N6O5 and a molecular weight of 498.50 g/mol. Its IUPAC name is 1-[6-[2-(4-methoxyphenyl)indazol-5-yl]oxy-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione.
| Compound Name | 1-[6-[2-(4-methoxyphenyl)indazol-5-yl]oxy-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 10074624 |
| Molecular Formula | C26H22N6O5 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 1-[6-[2-(4-methoxyphenyl)indazol-5-yl]oxy-3-pyridinyl]-1,7,9-triazaspiro[4.5]decane-6,8,10-trione |
| SMILES | COc1ccc(-n2cc3cc(Oc4ccc(N5CCCC56C(=O)NC(=O)NC6=O)cn4)ccc3n2)cc1 |
| InChI | InChI=1S/C26H22N6O5/c1-36-19-6-3-17(4-7-19)32-15-16-13-20(8-9-21(16)30-32)37-22-10-5-18(14-27-22)31-12-2-11-26(31)23(33)28-25(35)29-24(26)34/h3-10,13-15H,2,11-12H2,1H3,(H2,28,29,33,34,35) |
| InChIKey | LAVYNMJQBIZSSX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|