C29H45N3O4 — CID 10074684
(2R,4S,5S,7S)-5-amino-N-butyl-4-hydroxy-7-[[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]methyl]-2,8-dimethylnonanamide (PubChem CID 10074684) has the molecular formula C29H45N3O4 and a molecular weight of 499.70 g/mol. Its IUPAC name is (2R,4S,5S,7S)-5-amino-N-butyl-4-hydroxy-7-[[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]methyl]-2,8-dimethylnonanamide.
| Compound Name | (2R,4S,5S,7S)-5-amino-N-butyl-4-hydroxy-7-[[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]methyl]-2,8-dimethylnonanamide |
|---|---|
| PubChem CID | 10074684 |
| Molecular Formula | C29H45N3O4 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.34 |
| IUPAC Name | (2R,4S,5S,7S)-5-amino-N-butyl-4-hydroxy-7-[[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]methyl]-2,8-dimethylnonanamide |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@@H](N)C[C@H](Cc1ccc(OC)c(OCc2ccncc2)c1)C(C)C |
| InChI | InChI=1S/C29H45N3O4/c1-6-7-12-32-29(34)21(4)15-26(33)25(30)18-24(20(2)3)16-23-8-9-27(35-5)28(17-23)36-19-22-10-13-31-14-11-22/h8-11,13-14,17,20-21,24-26,33H,6-7,12,15-16,18-19,30H2,1-5H3,(H,32,34)/t21-,24+,25+,26+/m1/s1 |
| InChIKey | ZNJMRVDDTCUBGP-NDEVUPSOSA-N |
| XLogP | 4.50 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|