C27H31N3O5S — CID 100747134
(2S)-N-[[4-(diethylamino)phenyl]methyl]-4-(4-methoxyphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 100747134) has the molecular formula C27H31N3O5S and a molecular weight of 509.63 g/mol. Its IUPAC name is (2S)-N-[[4-(diethylamino)phenyl]methyl]-4-(4-methoxyphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2S)-N-[[4-(diethylamino)phenyl]methyl]-4-(4-methoxyphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 100747134 |
| Molecular Formula | C27H31N3O5S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | (2S)-N-[[4-(diethylamino)phenyl]methyl]-4-(4-methoxyphenyl)sulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)[C@@H]2CN(S(=O)(=O)c3ccc(OC)cc3)c3ccccc3O2)cc1 |
| InChI | InChI=1S/C27H31N3O5S/c1-4-29(5-2)21-12-10-20(11-13-21)18-28-27(31)26-19-30(24-8-6-7-9-25(24)35-26)36(32,33)23-16-14-22(34-3)15-17-23/h6-17,26H,4-5,18-19H2,1-3H3,(H,28,31)/t26-/m0/s1 |
| InChIKey | LBLGONMFVSMHPD-SANMLTNESA-N |
| XLogP | 3.81 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|