C15H15ClN4O2S — CID 100748186
1-[4-(4-chlorophenyl)thiadiazole-5-carbonyl]piperidine-4-carboxamide (PubChem CID 100748186) has the molecular formula C15H15ClN4O2S and a molecular weight of 350.83 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)thiadiazole-5-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-(4-chlorophenyl)thiadiazole-5-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 100748186 |
| Molecular Formula | C15H15ClN4O2S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 1-[4-(4-chlorophenyl)thiadiazole-5-carbonyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)c2snnc2-c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C15H15ClN4O2S/c16-11-3-1-9(2-4-11)12-13(23-19-18-12)15(22)20-7-5-10(6-8-20)14(17)21/h1-4,10H,5-8H2,(H2,17,21) |
| InChIKey | OXPJECDKHSUFCO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |