C22H29N3O6S — CID 100748404
N-(2-methoxyethyl)-2-[[(2R)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]butanoyl]amino]benzamide (PubChem CID 100748404) has the molecular formula C22H29N3O6S and a molecular weight of 463.56 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[(2R)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]butanoyl]amino]benzamide.
| Compound Name | N-(2-methoxyethyl)-2-[[(2R)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]butanoyl]amino]benzamide |
|---|---|
| PubChem CID | 100748404 |
| Molecular Formula | C22H29N3O6S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[(2R)-2-[4-[methyl(methylsulfonyl)amino]phenoxy]butanoyl]amino]benzamide |
| SMILES | CC[C@@H](Oc1ccc(N(C)S(C)(=O)=O)cc1)C(=O)Nc1ccccc1C(=O)NCCOC |
| InChI | InChI=1S/C22H29N3O6S/c1-5-20(31-17-12-10-16(11-13-17)25(2)32(4,28)29)22(27)24-19-9-7-6-8-18(19)21(26)23-14-15-30-3/h6-13,20H,5,14-15H2,1-4H3,(H,23,26)(H,24,27)/t20-/m1/s1 |
| InChIKey | UPYNGEIVITXELM-HXUWFJFHSA-N |
| XLogP | 2.25 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|