C25H26FNO3 — CID 100748983
4-(2-fluorophenyl)-N-(4-propan-2-yloxynaphthalen-1-yl)oxane-4-carboxamide (PubChem CID 100748983) has the molecular formula C25H26FNO3 and a molecular weight of 407.49 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N-(4-propan-2-yloxynaphthalen-1-yl)oxane-4-carboxamide.
| Compound Name | 4-(2-fluorophenyl)-N-(4-propan-2-yloxynaphthalen-1-yl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 100748983 |
| Molecular Formula | C25H26FNO3 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 4-(2-fluorophenyl)-N-(4-propan-2-yloxynaphthalen-1-yl)oxane-4-carboxamide |
| SMILES | CC(C)Oc1ccc(NC(=O)C2(c3ccccc3F)CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C25H26FNO3/c1-17(2)30-23-12-11-22(18-7-3-4-8-19(18)23)27-24(28)25(13-15-29-16-14-25)20-9-5-6-10-21(20)26/h3-12,17H,13-16H2,1-2H3,(H,27,28) |
| InChIKey | FAGYCZWFMNWDRI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |