About N-[[(3R)-3,4-dihydro-1H-isochromen-3-yl]methyl]pyridine-3-sulfonamide
N-[[(3R)-3,4-dihydro-1H-isochromen-3-yl]methyl]pyridine-3-sulfonamide (PubChem CID 100751542) has the molecular formula C15H16N2O3S
and a molecular weight of 304.37 g/mol. Its IUPAC name is N-[[(3R)-3,4-dihydro-1H-isochromen-3-yl]methyl]pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | N-[[(3R)-3,4-dihydro-1H-isochromen-3-yl]methyl]pyridine-3-sulfonamide |
| PubChem CID | 100751542 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N-[[(3R)-3,4-dihydro-1H-isochromen-3-yl]methyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NC[C@H]1Cc2ccccc2CO1)c1cccnc1 |
| InChI | InChI=1S/C15H16N2O3S/c18-21(19,15-6-3-7-16-10-15)17-9-14-8-12-4-1-2-5-13(12)11-20-14/h1-7,10,14,17H,8-9,11H2/t14-/m1/s1 |
| InChIKey | NOVUEDJUVUGZPT-CQSZACIVSA-N |
| XLogP | 1.50 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[(3R)-3,4-dihydro-1H-isochromen-3-yl]methyl]pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3R)-3,4-dihydro-1H-isochromen-3-yl]methyl]pyridine-3-sulfonamide?
The IUPAC name of N-[[(3R)-3,4-dihydro-1H-isochromen-3-yl]methyl]pyridine-3-sulfonamide (CID 100751542) is N-[[(3R)-3,4-dihydro-1H-isochromen-3-yl]methyl]pyridine-3-sulfonamide.
What is the SMILES notation for N-[[(3R)-3,4-dihydro-1H-isochromen-3-yl]methyl]pyridine-3-sulfonamide?
The canonical SMILES for N-[[(3R)-3,4-dihydro-1H-isochromen-3-yl]methyl]pyridine-3-sulfonamide is O=S(=O)(NC[C@H]1Cc2ccccc2CO1)c1cccnc1.
What is the InChIKey of N-[[(3R)-3,4-dihydro-1H-isochromen-3-yl]methyl]pyridine-3-sulfonamide?
The InChIKey is NOVUEDJUVUGZPT-CQSZACIVSA-N. The full InChI is InChI=1S/C15H16N2O3S/c18-21(19,15-6-3-7-16-10-15)17-9-14-8-12-4-1-2-5-13(12)11-20-14/h1-7,10,14,17H,8-9,11H2/t14-/m1/s1.
What are the key properties of N-[[(3R)-3,4-dihydro-1H-isochromen-3-yl]methyl]pyridine-3-sulfonamide?
N-[[(3R)-3,4-dihydro-1H-isochromen-3-yl]methyl]pyridine-3-sulfonamide has a molecular weight of 304.37 g/mol, XLogP of 1.50, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3R)-3,4-dihydro-1H-isochromen-3-yl]methyl]pyridine-3-sulfonamide is sourced from PubChem (CID 100751542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).