C15H21NO5S — CID 100752212
methyl (2R,3R)-2-methyl-3-[[(2R)-2-phenylpropanoyl]sulfamoyl]butanoate (PubChem CID 100752212) has the molecular formula C15H21NO5S and a molecular weight of 327.40 g/mol. Its IUPAC name is methyl (2R,3R)-2-methyl-3-[[(2R)-2-phenylpropanoyl]sulfamoyl]butanoate.
| Compound Name | methyl (2R,3R)-2-methyl-3-[[(2R)-2-phenylpropanoyl]sulfamoyl]butanoate |
|---|---|
| PubChem CID | 100752212 |
| Molecular Formula | C15H21NO5S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | methyl (2R,3R)-2-methyl-3-[[(2R)-2-phenylpropanoyl]sulfamoyl]butanoate |
| SMILES | COC(=O)[C@@H](C)[C@@H](C)S(=O)(=O)NC(=O)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C15H21NO5S/c1-10(15(18)21-4)12(3)22(19,20)16-14(17)11(2)13-8-6-5-7-9-13/h5-12H,1-4H3,(H,16,17)/t10-,11+,12+/m0/s1 |
| InChIKey | YUDKDSZFXLQGHP-QJPTWQEYSA-N |
| XLogP | 1.43 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |