C27H38F2N6O2 — CID 10075251
1-cyclopentyl-7-[4-(diethylamino)butylamino]-3-(3-ethoxy-2,6-difluorophenyl)-4H-pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 10075251) has the molecular formula C27H38F2N6O2 and a molecular weight of 516.64 g/mol. Its IUPAC name is 1-cyclopentyl-7-[4-(diethylamino)butylamino]-3-(3-ethoxy-2,6-difluorophenyl)-4H-pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 1-cyclopentyl-7-[4-(diethylamino)butylamino]-3-(3-ethoxy-2,6-difluorophenyl)-4H-pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 10075251 |
| Molecular Formula | C27H38F2N6O2 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 1-cyclopentyl-7-[4-(diethylamino)butylamino]-3-(3-ethoxy-2,6-difluorophenyl)-4H-pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | CCOc1ccc(F)c(N2Cc3cnc(NCCCCN(CC)CC)nc3N(C3CCCC3)C2=O)c1F |
| InChI | InChI=1S/C27H38F2N6O2/c1-4-33(5-2)16-10-9-15-30-26-31-17-19-18-34(24-21(28)13-14-22(23(24)29)37-6-3)27(36)35(25(19)32-26)20-11-7-8-12-20/h13-14,17,20H,4-12,15-16,18H2,1-3H3,(H,30,31,32) |
| InChIKey | IAQNQDYSXYMPHK-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|