C17H19N3O5 — CID 100754022
methyl 2-[3-[(6-morpholin-4-yl-3-pyridinyl)carbamoyl]furan-2-yl]acetate (PubChem CID 100754022) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is methyl 2-[3-[(6-morpholin-4-yl-3-pyridinyl)carbamoyl]furan-2-yl]acetate.
| Compound Name | methyl 2-[3-[(6-morpholin-4-yl-3-pyridinyl)carbamoyl]furan-2-yl]acetate |
|---|---|
| PubChem CID | 100754022 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | methyl 2-[3-[(6-morpholin-4-yl-3-pyridinyl)carbamoyl]furan-2-yl]acetate |
| SMILES | COC(=O)Cc1occc1C(=O)Nc1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C17H19N3O5/c1-23-16(21)10-14-13(4-7-25-14)17(22)19-12-2-3-15(18-11-12)20-5-8-24-9-6-20/h2-4,7,11H,5-6,8-10H2,1H3,(H,19,22) |
| InChIKey | YAAXIMKUJDJRBM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |