C13H15Cl2N3O2 — CID 100756034
3-amino-2,4-dichloro-N-[(3S)-1-methyl-6-oxopiperidin-3-yl]benzamide (PubChem CID 100756034) has the molecular formula C13H15Cl2N3O2 and a molecular weight of 316.19 g/mol. Its IUPAC name is 3-amino-2,4-dichloro-N-[(3S)-1-methyl-6-oxopiperidin-3-yl]benzamide.
| Compound Name | 3-amino-2,4-dichloro-N-[(3S)-1-methyl-6-oxopiperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 100756034 |
| Molecular Formula | C13H15Cl2N3O2 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 3-amino-2,4-dichloro-N-[(3S)-1-methyl-6-oxopiperidin-3-yl]benzamide |
| SMILES | CN1C[C@@H](NC(=O)c2ccc(Cl)c(N)c2Cl)CCC1=O |
| InChI | InChI=1S/C13H15Cl2N3O2/c1-18-6-7(2-5-10(18)19)17-13(20)8-3-4-9(14)12(16)11(8)15/h3-4,7H,2,5-6,16H2,1H3,(H,17,20)/t7-/m0/s1 |
| InChIKey | CKOFIXLNPJWADE-ZETCQYMHSA-N |
| XLogP | 1.93 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|