About bis(dimethylcarbamic acid);triphenylstibane
bis(dimethylcarbamic acid);triphenylstibane (PubChem CID 10075653) has the molecular formula C24H29N2O4Sb
and a molecular weight of 531.27 g/mol. Its IUPAC name is bis(dimethylcarbamic acid);triphenylstibane.
Molecular Properties
| Compound Name | bis(dimethylcarbamic acid);triphenylstibane |
| PubChem CID | 10075653 |
| Molecular Formula | C24H29N2O4Sb |
| Molecular Weight | 531.27 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | bis(dimethylcarbamic acid);triphenylstibane |
| SMILES | CN(C)C(=O)O.CN(C)C(=O)O.c1ccc([Sb](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/3C6H5.2C3H7NO2.Sb/c3*1-2-4-6-5-3-1;2*1-4(2)3(5)6;/h3*1-5H;2*1-2H3,(H,5,6); |
| InChIKey | XSPYLXPGVIRUIV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 531.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(dimethylcarbamic acid);triphenylstibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dimethylcarbamic acid);triphenylstibane?
The IUPAC name of bis(dimethylcarbamic acid);triphenylstibane (CID 10075653) is bis(dimethylcarbamic acid);triphenylstibane.
What is the SMILES notation for bis(dimethylcarbamic acid);triphenylstibane?
The canonical SMILES for bis(dimethylcarbamic acid);triphenylstibane is CN(C)C(=O)O.CN(C)C(=O)O.c1ccc([Sb](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of bis(dimethylcarbamic acid);triphenylstibane?
The InChIKey is XSPYLXPGVIRUIV-UHFFFAOYSA-N. The full InChI is InChI=1S/3C6H5.2C3H7NO2.Sb/c3*1-2-4-6-5-3-1;2*1-4(2)3(5)6;/h3*1-5H;2*1-2H3,(H,5,6);.
What are the key properties of bis(dimethylcarbamic acid);triphenylstibane?
bis(dimethylcarbamic acid);triphenylstibane has a molecular weight of 531.27 g/mol, XLogP of 2.65, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dimethylcarbamic acid);triphenylstibane is sourced from PubChem (CID 10075653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).