C28H27N5O4S — CID 10075664
6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]-N-(4-phenylmethoxyphenyl)pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 10075664) has the molecular formula C28H27N5O4S and a molecular weight of 529.62 g/mol. Its IUPAC name is 6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]-N-(4-phenylmethoxyphenyl)pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]-N-(4-phenylmethoxyphenyl)pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 10075664 |
| Molecular Formula | C28H27N5O4S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]-N-(4-phenylmethoxyphenyl)pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CS(=O)(=O)CCNCc1ccc(-c2cc3c(Nc4ccc(OCc5ccccc5)cc4)ncnc3cn2)o1 |
| InChI | InChI=1S/C28H27N5O4S/c1-38(34,35)14-13-29-16-23-11-12-27(37-23)25-15-24-26(17-30-25)31-19-32-28(24)33-21-7-9-22(10-8-21)36-18-20-5-3-2-4-6-20/h2-12,15,17,19,29H,13-14,16,18H2,1H3,(H,31,32,33) |
| InChIKey | LOOADDNERSICKU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|