C30H43NO5S — CID 10075671
[(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxo-2-phenylacetate (PubChem CID 10075671) has the molecular formula C30H43NO5S and a molecular weight of 529.74 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxo-2-phenylacetate.
| Compound Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxo-2-phenylacetate |
|---|---|
| PubChem CID | 10075671 |
| Molecular Formula | C30H43NO5S |
| Molecular Weight | 529.74 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | [(1S,2R,4R)-1-(dicyclohexylsulfamoylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxo-2-phenylacetate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)N(C1CCCCC1)C1CCCCC1)[C@H](OC(=O)C(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C30H43NO5S/c1-29(2)23-18-19-30(29,26(20-23)36-28(33)27(32)22-12-6-3-7-13-22)21-37(34,35)31(24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3,6-7,12-13,23-26H,4-5,8-11,14-21H2,1-2H3/t23-,26-,30-/m1/s1 |
| InChIKey | VIMQQUQRMPZSRN-XUQXIDOOSA-N |
| XLogP | 5.90 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.74 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|