C16H27F3N2O3 — CID 100757309
(3R)-N-[[1-(2-ethoxyethyl)cyclobutyl]methyl]-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide (PubChem CID 100757309) has the molecular formula C16H27F3N2O3 and a molecular weight of 352.40 g/mol. Its IUPAC name is (3R)-N-[[1-(2-ethoxyethyl)cyclobutyl]methyl]-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide.
| Compound Name | (3R)-N-[[1-(2-ethoxyethyl)cyclobutyl]methyl]-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 100757309 |
| Molecular Formula | C16H27F3N2O3 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (3R)-N-[[1-(2-ethoxyethyl)cyclobutyl]methyl]-4-(2,2,2-trifluoroethyl)morpholine-3-carboxamide |
| SMILES | CCOCCC1(CNC(=O)[C@H]2COCCN2CC(F)(F)F)CCC1 |
| InChI | InChI=1S/C16H27F3N2O3/c1-2-23-8-6-15(4-3-5-15)11-20-14(22)13-10-24-9-7-21(13)12-16(17,18)19/h13H,2-12H2,1H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | KECFTSBTAHGPFP-CYBMUJFWSA-N |
| XLogP | 1.96 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|