About (2R)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethyl)phenyl]methyl]butanamide
(2R)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethyl)phenyl]methyl]butanamide (PubChem CID 100757725) has the molecular formula C17H19F3N2O2
and a molecular weight of 340.35 g/mol. Its IUPAC name is (2R)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethyl)phenyl]methyl]butanamide.
Molecular Properties
| Compound Name | (2R)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethyl)phenyl]methyl]butanamide |
| PubChem CID | 100757725 |
| Molecular Formula | C17H19F3N2O2 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (2R)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethyl)phenyl]methyl]butanamide |
| SMILES | CC[C@H](Cc1ccc(C(F)(F)F)cc1)C(=O)NCc1ncc(C)o1 |
| InChI | InChI=1S/C17H19F3N2O2/c1-3-13(16(23)22-10-15-21-9-11(2)24-15)8-12-4-6-14(7-5-12)17(18,19)20/h4-7,9,13H,3,8,10H2,1-2H3,(H,22,23)/t13-/m1/s1 |
| InChIKey | DGTHKCYUPHLKCF-CYBMUJFWSA-N |
| XLogP | 3.89 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethyl)phenyl]methyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethyl)phenyl]methyl]butanamide?
The IUPAC name of (2R)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethyl)phenyl]methyl]butanamide (CID 100757725) is (2R)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethyl)phenyl]methyl]butanamide.
What is the SMILES notation for (2R)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethyl)phenyl]methyl]butanamide?
The canonical SMILES for (2R)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethyl)phenyl]methyl]butanamide is CC[C@H](Cc1ccc(C(F)(F)F)cc1)C(=O)NCc1ncc(C)o1.
What is the InChIKey of (2R)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethyl)phenyl]methyl]butanamide?
The InChIKey is DGTHKCYUPHLKCF-CYBMUJFWSA-N. The full InChI is InChI=1S/C17H19F3N2O2/c1-3-13(16(23)22-10-15-21-9-11(2)24-15)8-12-4-6-14(7-5-12)17(18,19)20/h4-7,9,13H,3,8,10H2,1-2H3,(H,22,23)/t13-/m1/s1.
What are the key properties of (2R)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethyl)phenyl]methyl]butanamide?
(2R)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethyl)phenyl]methyl]butanamide has a molecular weight of 340.35 g/mol, XLogP of 3.89, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethyl)phenyl]methyl]butanamide is sourced from PubChem (CID 100757725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).