C15H21N3OS — CID 100757800
1-(3,5-dimethylphenyl)-3-[2-(2-oxopyrrolidin-1-yl)ethyl]thiourea (PubChem CID 100757800) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[2-(2-oxopyrrolidin-1-yl)ethyl]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[2-(2-oxopyrrolidin-1-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 100757800 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[2-(2-oxopyrrolidin-1-yl)ethyl]thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)NCCN2CCCC2=O)c1 |
| InChI | InChI=1S/C15H21N3OS/c1-11-8-12(2)10-13(9-11)17-15(20)16-5-7-18-6-3-4-14(18)19/h8-10H,3-7H2,1-2H3,(H2,16,17,20) |
| InChIKey | XMOUKMQNOHCSHC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|