C22H23F3N2O2 — CID 100758159
1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-2-[3-(trifluoromethyl)phenoxy]ethanone (PubChem CID 100758159) has the molecular formula C22H23F3N2O2 and a molecular weight of 404.43 g/mol. Its IUPAC name is 1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-2-[3-(trifluoromethyl)phenoxy]ethanone.
| Compound Name | 1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-2-[3-(trifluoromethyl)phenoxy]ethanone |
|---|---|
| PubChem CID | 100758159 |
| Molecular Formula | C22H23F3N2O2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-2-[3-(trifluoromethyl)phenoxy]ethanone |
| SMILES | O=C(COc1cccc(C(F)(F)F)c1)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C22H23F3N2O2/c23-22(24,25)19-9-4-10-20(16-19)29-17-21(28)27-14-12-26(13-15-27)11-5-8-18-6-2-1-3-7-18/h1-10,16H,11-15,17H2/b8-5+ |
| InChIKey | MVDNTKPFMVMHIQ-VMPITWQZSA-N |
| XLogP | 3.94 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |