C16H13F5N6O2 — CID 100758490
N-[3-(1H-imidazo[4,5-b]pyridin-2-yl)propyl]-5-nitro-2-(1,1,2,2,2-pentafluoroethyl)pyridin-4-amine (PubChem CID 100758490) has the molecular formula C16H13F5N6O2 and a molecular weight of 416.31 g/mol. Its IUPAC name is N-[3-(1H-imidazo[4,5-b]pyridin-2-yl)propyl]-5-nitro-2-(1,1,2,2,2-pentafluoroethyl)pyridin-4-amine.
| Compound Name | N-[3-(1H-imidazo[4,5-b]pyridin-2-yl)propyl]-5-nitro-2-(1,1,2,2,2-pentafluoroethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 100758490 |
| Molecular Formula | C16H13F5N6O2 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-[3-(1H-imidazo[4,5-b]pyridin-2-yl)propyl]-5-nitro-2-(1,1,2,2,2-pentafluoroethyl)pyridin-4-amine |
| SMILES | O=[N+]([O-])c1cnc(C(F)(F)C(F)(F)F)cc1NCCCc1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C16H13F5N6O2/c17-15(18,16(19,20)21)12-7-10(11(8-24-12)27(28)29)22-5-2-4-13-25-9-3-1-6-23-14(9)26-13/h1,3,6-8H,2,4-5H2,(H,22,24)(H,23,25,26) |
| InChIKey | AAFHTEPEDDDAKU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|