C32H60O4Si — CID 10075870
[(2R,3S,6R)-6-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]-2-(oxiran-2-yl)heptan-3-yl]oxy-triethylsilane (PubChem CID 10075870) has the molecular formula C32H60O4Si and a molecular weight of 536.91 g/mol. Its IUPAC name is [(2R,3S,6R)-6-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]-2-(oxiran-2-yl)heptan-3-yl]oxy-triethylsilane.
| Compound Name | [(2R,3S,6R)-6-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]-2-(oxiran-2-yl)heptan-3-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 10075870 |
| Molecular Formula | C32H60O4Si |
| Molecular Weight | 536.91 g/mol |
| Exact Mass | 536.43 |
| IUPAC Name | [(2R,3S,6R)-6-[(2S,3S,6R,8S,9R)-3,9-dimethyl-8-[(3S)-3-methylpent-4-enyl]-1,7-dioxaspiro[5.5]undecan-2-yl]-2-(oxiran-2-yl)heptan-3-yl]oxy-triethylsilane |
| SMILES | C=C[C@@H](C)CC[C@@H]1O[C@@]2(CC[C@H]1C)CC[C@H](C)[C@H]([C@H](C)CC[C@H](O[Si](CC)(CC)CC)[C@H](C)C1CO1)O2 |
| InChI | InChI=1S/C32H60O4Si/c1-10-23(5)14-16-28-24(6)18-20-32(34-28)21-19-26(8)31(35-32)25(7)15-17-29(27(9)30-22-33-30)36-37(11-2,12-3)13-4/h10,23-31H,1,11-22H2,2-9H3/t23-,24-,25-,26+,27+,28+,29+,30?,31+,32-/m1/s1 |
| InChIKey | YJHPJBJETBCPBL-VOAAUPHFSA-N |
| XLogP | 8.76 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.91 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|