C24H25NO3S — CID 100760048
N-benzhydryl-3-methoxy-5,6,7,8-tetrahydronaphthalene-2-sulfonamide (PubChem CID 100760048) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-benzhydryl-3-methoxy-5,6,7,8-tetrahydronaphthalene-2-sulfonamide.
| Compound Name | N-benzhydryl-3-methoxy-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 100760048 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-benzhydryl-3-methoxy-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
| SMILES | COc1cc2c(cc1S(=O)(=O)NC(c1ccccc1)c1ccccc1)CCCC2 |
| InChI | InChI=1S/C24H25NO3S/c1-28-22-16-20-14-8-9-15-21(20)17-23(22)29(26,27)25-24(18-10-4-2-5-11-18)19-12-6-3-7-13-19/h2-7,10-13,16-17,24-25H,8-9,14-15H2,1H3 |
| InChIKey | PMRBGYVDNJOLNL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |