C27H49FO6Si2 — CID 10076087
[(2S)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] (1R,4S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7-(3-fluoropropyl)-3-oxo-2-oxabicyclo[2.2.2]oct-5-ene-4-carboxylate (PubChem CID 10076087) has the molecular formula C27H49FO6Si2 and a molecular weight of 544.85 g/mol. Its IUPAC name is [(2S)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] (1R,4S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7-(3-fluoropropyl)-3-oxo-2-oxabicyclo[2.2.2]oct-5-ene-4-carboxylate.
| Compound Name | [(2S)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] (1R,4S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7-(3-fluoropropyl)-3-oxo-2-oxabicyclo[2.2.2]oct-5-ene-4-carboxylate |
|---|---|
| PubChem CID | 10076087 |
| Molecular Formula | C27H49FO6Si2 |
| Molecular Weight | 544.85 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | [(2S)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] (1R,4S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-7-(3-fluoropropyl)-3-oxo-2-oxabicyclo[2.2.2]oct-5-ene-4-carboxylate |
| SMILES | C[C@@H](CCO[Si](C)(C)C(C)(C)C)OC(=O)[C@@]12C=C[C@@H](OC1=O)[C@@H](CCCF)[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H49FO6Si2/c1-19(15-18-31-35(8,9)25(2,3)4)32-23(29)27-16-14-21(33-24(27)30)20(13-12-17-28)22(27)34-36(10,11)26(5,6)7/h14,16,19-22H,12-13,15,17-18H2,1-11H3/t19-,20+,21+,22+,27-/m0/s1 |
| InChIKey | LFDGIWSYIXWNGB-RUGVOOQCSA-N |
| XLogP | 6.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.85 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|