C15H16BrFN4O2S — CID 100761949
4-[(3S)-1-(4-bromo-2-fluorophenyl)sulfonylpiperidin-3-yl]pyrimidin-2-amine (PubChem CID 100761949) has the molecular formula C15H16BrFN4O2S and a molecular weight of 415.29 g/mol. Its IUPAC name is 4-[(3S)-1-(4-bromo-2-fluorophenyl)sulfonylpiperidin-3-yl]pyrimidin-2-amine.
| Compound Name | 4-[(3S)-1-(4-bromo-2-fluorophenyl)sulfonylpiperidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 100761949 |
| Molecular Formula | C15H16BrFN4O2S |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 4-[(3S)-1-(4-bromo-2-fluorophenyl)sulfonylpiperidin-3-yl]pyrimidin-2-amine |
| SMILES | Nc1nccc([C@H]2CCCN(S(=O)(=O)c3ccc(Br)cc3F)C2)n1 |
| InChI | InChI=1S/C15H16BrFN4O2S/c16-11-3-4-14(12(17)8-11)24(22,23)21-7-1-2-10(9-21)13-5-6-19-15(18)20-13/h3-6,8,10H,1-2,7,9H2,(H2,18,19,20)/t10-/m0/s1 |
| InChIKey | ZYLYKZKJVQMFSB-JTQLQIEISA-N |
| XLogP | 2.53 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |