C25H27N3O2 — CID 100762171
N-[2-(cyclohexen-1-yl)ethyl]-3-[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]propanamide (PubChem CID 100762171) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]propanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]propanamide |
|---|---|
| PubChem CID | 100762171 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[3-(4-phenylphenyl)-1,2,4-oxadiazol-5-yl]propanamide |
| SMILES | O=C(CCc1nc(-c2ccc(-c3ccccc3)cc2)no1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C25H27N3O2/c29-23(26-18-17-19-7-3-1-4-8-19)15-16-24-27-25(28-30-24)22-13-11-21(12-14-22)20-9-5-2-6-10-20/h2,5-7,9-14H,1,3-4,8,15-18H2,(H,26,29) |
| InChIKey | VPJMDHCRAYIVHY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|