C22H30BrClO5SSi — CID 10076230
[(E,1S)-1-[(2R,3S,6S)-3-[bromomethyl(dimethyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-4-phenylsulfanylbut-2-enyl] 2-chloroacetate (PubChem CID 10076230) has the molecular formula C22H30BrClO5SSi and a molecular weight of 549.99 g/mol. Its IUPAC name is [(E,1S)-1-[(2R,3S,6S)-3-[bromomethyl(dimethyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-4-phenylsulfanylbut-2-enyl] 2-chloroacetate.
| Compound Name | [(E,1S)-1-[(2R,3S,6S)-3-[bromomethyl(dimethyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-4-phenylsulfanylbut-2-enyl] 2-chloroacetate |
|---|---|
| PubChem CID | 10076230 |
| Molecular Formula | C22H30BrClO5SSi |
| Molecular Weight | 549.99 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | [(E,1S)-1-[(2R,3S,6S)-3-[bromomethyl(dimethyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-4-phenylsulfanylbut-2-enyl] 2-chloroacetate |
| SMILES | CCO[C@@H]1C=C[C@H](O[Si](C)(C)CBr)[C@@H]([C@H](/C=C/CSc2ccccc2)OC(=O)CCl)O1 |
| InChI | InChI=1S/C22H30BrClO5SSi/c1-4-26-21-13-12-19(29-31(2,3)16-23)22(28-21)18(27-20(25)15-24)11-8-14-30-17-9-6-5-7-10-17/h5-13,18-19,21-22H,4,14-16H2,1-3H3/b11-8+/t18-,19-,21-,22+/m0/s1 |
| InChIKey | CCSYWAJPQQIROY-QMKBEHIVSA-N |
| XLogP | 5.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.99 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|