C20H16Cl2F3N5O3S2 — CID 100762397
2,4-dichloro-N-[5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100762397) has the molecular formula C20H16Cl2F3N5O3S2 and a molecular weight of 566.41 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100762397 |
| Molecular Formula | C20H16Cl2F3N5O3S2 |
| Molecular Weight | 566.41 g/mol |
| Exact Mass | 565.00 |
| IUPAC Name | 2,4-dichloro-N-[5-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)N2CCN(c3cccc(C(F)(F)F)c3)CC2)s1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H16Cl2F3N5O3S2/c21-13-4-5-15(16(22)11-13)17(31)26-18-27-28-19(34-18)35(32,33)30-8-6-29(7-9-30)14-3-1-2-12(10-14)20(23,24)25/h1-5,10-11H,6-9H2,(H,26,27,31) |
| InChIKey | VAONZWFDQVSTFL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|